C28H30BClF3N3O4 — CID 178136604
5-[[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-2-(1,3-dihydroisoindol-2-ylmethyl)-3-(2,2,2-trifluoroethyl)pyrimidin-4-one (PubChem CID 178136604) has the molecular formula C28H30BClF3N3O4 and a molecular weight of 575.82 g/mol. Its IUPAC name is 5-[[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-2-(1,3-dihydroisoindol-2-ylmethyl)-3-(2,2,2-trifluoroethyl)pyrimidin-4-one.
| Compound Name | 5-[[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-2-(1,3-dihydroisoindol-2-ylmethyl)-3-(2,2,2-trifluoroethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 178136604 |
| Molecular Formula | C28H30BClF3N3O4 |
| Molecular Weight | 575.82 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 5-[[3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]-2-(1,3-dihydroisoindol-2-ylmethyl)-3-(2,2,2-trifluoroethyl)pyrimidin-4-one |
| SMILES | CC1(C)OB(c2ccc(COc3cnc(CN4Cc5ccccc5C4)n(CC(F)(F)F)c3=O)cc2Cl)OC1(C)C |
| InChI | InChI=1S/C28H30BClF3N3O4/c1-26(2)27(3,4)40-29(39-26)21-10-9-18(11-22(21)30)16-38-23-12-34-24(36(25(23)37)17-28(31,32)33)15-35-13-19-7-5-6-8-20(19)14-35/h5-12H,13-17H2,1-4H3 |
| InChIKey | GBWKXIUINXFSCZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.82 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|