C7H15FNO2S+ — CID 178137021
(1,1-dioxothietan-3-yl)-(2-fluoroethyl)-dimethylazanium (PubChem CID 178137021) has the molecular formula C7H15FNO2S+ and a molecular weight of 196.27 g/mol. Its IUPAC name is (1,1-dioxothietan-3-yl)-(2-fluoroethyl)-dimethylazanium.
| Compound Name | (1,1-dioxothietan-3-yl)-(2-fluoroethyl)-dimethylazanium |
|---|---|
| PubChem CID | 178137021 |
| Molecular Formula | C7H15FNO2S+ |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (1,1-dioxothietan-3-yl)-(2-fluoroethyl)-dimethylazanium |
| SMILES | C[N+](C)(CCF)C1CS(=O)(=O)C1 |
| InChI | InChI=1S/C7H15FNO2S/c1-9(2,4-3-8)7-5-12(10,11)6-7/h7H,3-6H2,1-2H3/q+1 |
| InChIKey | MYGLJGCVLOVXTC-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|