C22H21NO3 — CID 178137503
7-[3-(3-ethynylpyrrolidin-1-yl)propanoyl]-2,3-dihydrobenzo[g]chromen-4-one (PubChem CID 178137503) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is 7-[3-(3-ethynylpyrrolidin-1-yl)propanoyl]-2,3-dihydrobenzo[g]chromen-4-one.
| Compound Name | 7-[3-(3-ethynylpyrrolidin-1-yl)propanoyl]-2,3-dihydrobenzo[g]chromen-4-one |
|---|---|
| PubChem CID | 178137503 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 7-[3-(3-ethynylpyrrolidin-1-yl)propanoyl]-2,3-dihydrobenzo[g]chromen-4-one |
| SMILES | C#CC1CCN(CCC(=O)c2ccc3cc4c(cc3c2)C(=O)CCO4)C1 |
| InChI | InChI=1S/C22H21NO3/c1-2-15-5-8-23(14-15)9-6-20(24)17-4-3-16-13-22-19(12-18(16)11-17)21(25)7-10-26-22/h1,3-4,11-13,15H,5-10,14H2 |
| InChIKey | OBOPDIIAKVWJLE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|