About CID 178137818
CID 178137818 (PubChem CID 178137818) has the molecular formula C6H7BOP
and a molecular weight of 136.91 g/mol.
Molecular Properties
| Compound Name | CID 178137818 |
| PubChem CID | 178137818 |
| Molecular Formula | C6H7BOP |
| Molecular Weight | 136.91 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | — |
| SMILES | O[B]c1ccccc1P |
| InChI | InChI=1S/C6H7BOP/c8-7-5-3-1-2-4-6(5)9/h1-4,8H,9H2 |
| InChIKey | LADYNJNUMKZRQI-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.91 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 178137818 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178137818?
The IUPAC name of CID 178137818 (CID 178137818) is not available.
What is the SMILES notation for CID 178137818?
The canonical SMILES for CID 178137818 is O[B]c1ccccc1P.
What is the InChIKey of CID 178137818?
The InChIKey is LADYNJNUMKZRQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BOP/c8-7-5-3-1-2-4-6(5)9/h1-4,8H,9H2.
What are the key properties of CID 178137818?
CID 178137818 has a molecular weight of 136.91 g/mol, XLogP of -0.58, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178137818 is sourced from PubChem (CID 178137818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).