C14H20N2S — CID 178137897
1-[5-[(3Z,5Z)-nona-1,3,5-trien-2-yl]-1,3-thiazol-2-yl]ethanamine (PubChem CID 178137897) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 1-[5-[(3Z,5Z)-nona-1,3,5-trien-2-yl]-1,3-thiazol-2-yl]ethanamine.
| Compound Name | 1-[5-[(3Z,5Z)-nona-1,3,5-trien-2-yl]-1,3-thiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 178137897 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-[5-[(3Z,5Z)-nona-1,3,5-trien-2-yl]-1,3-thiazol-2-yl]ethanamine |
| SMILES | C=C(/C=C\C=C/CCC)c1cnc(C(C)N)s1 |
| InChI | InChI=1S/C14H20N2S/c1-4-5-6-7-8-9-11(2)13-10-16-14(17-13)12(3)15/h6-10,12H,2,4-5,15H2,1,3H3/b7-6-,9-8- |
| InChIKey | ITCSQVYCSKPOOQ-JPDBVBESSA-N |
| XLogP | 4.09 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|