ethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate

C10H16O2S — CID 178137935

IUPACethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate
SMILESCCOC(=O)CCC1=CC(C)CS1
InChIInChI=1S/C10H16O2S/c1-3-12-10(11)5-4-9-6-8(2)7-13-9/h6,8H,3-5,7H2,1-2H3
InChIKeyLHVHOJDITVQRER-UHFFFAOYSA-N
MW200.30 g/mol
LogP2.60
Rot. Bonds4

About ethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate

ethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate (PubChem CID 178137935) has the molecular formula C10H16O2S and a molecular weight of 200.30 g/mol. Its IUPAC name is ethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate.

Molecular Properties

Compound Nameethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate
PubChem CID178137935
Molecular FormulaC10H16O2S
Molecular Weight200.30 g/mol
Exact Mass200.09
IUPAC Nameethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate
SMILESCCOC(=O)CCC1=CC(C)CS1
InChIInChI=1S/C10H16O2S/c1-3-12-10(11)5-4-9-6-8(2)7-13-9/h6,8H,3-5,7H2,1-2H3
InChIKeyLHVHOJDITVQRER-UHFFFAOYSA-N
XLogP2.60
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.30
LogP ≤ 52.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate?
The IUPAC name of ethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate (CID 178137935) is ethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate.
What is the SMILES notation for ethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate?
The canonical SMILES for ethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate is CCOC(=O)CCC1=CC(C)CS1.
What is the InChIKey of ethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate?
The InChIKey is LHVHOJDITVQRER-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2S/c1-3-12-10(11)5-4-9-6-8(2)7-13-9/h6,8H,3-5,7H2,1-2H3.
What are the key properties of ethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate?
ethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate has a molecular weight of 200.30 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(3-methyl-2,3-dihydrothiophen-5-yl)propanoate is sourced from PubChem (CID 178137935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).