C9H13N3O3 — CID 178138236
(6S)-3-amino-6-[hydroxy(methoxy)methyl]-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one (PubChem CID 178138236) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is (6S)-3-amino-6-[hydroxy(methoxy)methyl]-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one.
| Compound Name | (6S)-3-amino-6-[hydroxy(methoxy)methyl]-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 178138236 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (6S)-3-amino-6-[hydroxy(methoxy)methyl]-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one |
| SMILES | COC(O)[C@@H]1CCc2ncc(N)c(=O)n21 |
| InChI | InChI=1S/C9H13N3O3/c1-15-9(14)6-2-3-7-11-4-5(10)8(13)12(6)7/h4,6,9,14H,2-3,10H2,1H3/t6-,9?/m0/s1 |
| InChIKey | HCLPLZLXCXPXMD-AADKRJSRSA-N |
| XLogP | -0.72 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|