C18H20N6O3S — CID 178138319
N-[(6-aminothieno[3,2-c]pyridin-2-yl)methyl]-5-[(E)-2-formamido-3-oxoprop-1-enyl]imino-1-methylpyrrolidine-2-carboxamide (PubChem CID 178138319) has the molecular formula C18H20N6O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-[(6-aminothieno[3,2-c]pyridin-2-yl)methyl]-5-[(E)-2-formamido-3-oxoprop-1-enyl]imino-1-methylpyrrolidine-2-carboxamide.
| Compound Name | N-[(6-aminothieno[3,2-c]pyridin-2-yl)methyl]-5-[(E)-2-formamido-3-oxoprop-1-enyl]imino-1-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 178138319 |
| Molecular Formula | C18H20N6O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-[(6-aminothieno[3,2-c]pyridin-2-yl)methyl]-5-[(E)-2-formamido-3-oxoprop-1-enyl]imino-1-methylpyrrolidine-2-carboxamide |
| SMILES | CN1/C(=N/C=C(\C=O)NC=O)CCC1C(=O)NCc1cc2cnc(N)cc2s1 |
| InChI | InChI=1S/C18H20N6O3S/c1-24-14(2-3-17(24)21-7-12(9-25)23-10-26)18(27)22-8-13-4-11-6-20-16(19)5-15(11)28-13/h4-7,9-10,14H,2-3,8H2,1H3,(H2,19,20)(H,22,27)(H,23,26)/b12-7+,21-17+ |
| InChIKey | SWCYWVGATZCNTG-IGCIHTSUSA-N |
| XLogP | 0.77 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|