C14H16FN3O2S — CID 178138527
(NE,R)-N-[1-[5-(3-fluorophenyl)-1,2,4-oxadiazol-3-yl]ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 178138527) has the molecular formula C14H16FN3O2S and a molecular weight of 309.37 g/mol. Its IUPAC name is (NE,R)-N-[1-[5-(3-fluorophenyl)-1,2,4-oxadiazol-3-yl]ethylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-[1-[5-(3-fluorophenyl)-1,2,4-oxadiazol-3-yl]ethylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 178138527 |
| Molecular Formula | C14H16FN3O2S |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | (NE,R)-N-[1-[5-(3-fluorophenyl)-1,2,4-oxadiazol-3-yl]ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | C/C(=N\[S@](=O)C(C)(C)C)c1noc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C14H16FN3O2S/c1-9(18-21(19)14(2,3)4)12-16-13(20-17-12)10-6-5-7-11(15)8-10/h5-8H,1-4H3/b18-9+/t21-/m1/s1 |
| InChIKey | LFAPNAZTIKGXMA-MZPCATCRSA-N |
| XLogP | 3.15 |
| TPSA | 68.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|