About 3-bromo-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde
3-bromo-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde (PubChem CID 178138588) has the molecular formula C8H7BrN2O2
and a molecular weight of 243.06 g/mol. Its IUPAC name is 3-bromo-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde.
Molecular Properties
| Compound Name | 3-bromo-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde |
| PubChem CID | 178138588 |
| Molecular Formula | C8H7BrN2O2 |
| Molecular Weight | 243.06 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 3-bromo-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde |
| SMILES | O=CC1CCc2ncc(Br)c(=O)n21 |
| InChI | InChI=1S/C8H7BrN2O2/c9-6-3-10-7-2-1-5(4-12)11(7)8(6)13/h3-5H,1-2H2 |
| InChIKey | OTVQMAUHUBWAFE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.06 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde?
The IUPAC name of 3-bromo-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde (CID 178138588) is 3-bromo-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde.
What is the SMILES notation for 3-bromo-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde?
The canonical SMILES for 3-bromo-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde is O=CC1CCc2ncc(Br)c(=O)n21.
What is the InChIKey of 3-bromo-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde?
The InChIKey is OTVQMAUHUBWAFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2O2/c9-6-3-10-7-2-1-5(4-12)11(7)8(6)13/h3-5H,1-2H2.
What are the key properties of 3-bromo-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde?
3-bromo-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde has a molecular weight of 243.06 g/mol, XLogP of 0.69, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-oxo-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidine-6-carbaldehyde is sourced from PubChem (CID 178138588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).