About (2-oxoethanimidoyl) 3-methylbenzenecarboximidothioate
(2-oxoethanimidoyl) 3-methylbenzenecarboximidothioate (PubChem CID 178139231) has the molecular formula C10H10N2OS
and a molecular weight of 206.27 g/mol. Its IUPAC name is (2-oxoethanimidoyl) 3-methylbenzenecarboximidothioate.
Molecular Properties
| Compound Name | (2-oxoethanimidoyl) 3-methylbenzenecarboximidothioate |
| PubChem CID | 178139231 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | (2-oxoethanimidoyl) 3-methylbenzenecarboximidothioate |
| SMILES | [H]/N=C(\S/C(C=O)=N/[H])c1cccc(C)c1 |
| InChI | InChI=1S/C10H10N2OS/c1-7-3-2-4-8(5-7)10(12)14-9(11)6-13/h2-6,11-12H,1H3/b11-9+,12-10- |
| InChIKey | MINXFZNURHAEON-IXIPZQGVSA-N |
| XLogP | 2.23 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2-oxoethanimidoyl) 3-methylbenzenecarboximidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxoethanimidoyl) 3-methylbenzenecarboximidothioate?
The IUPAC name of (2-oxoethanimidoyl) 3-methylbenzenecarboximidothioate (CID 178139231) is (2-oxoethanimidoyl) 3-methylbenzenecarboximidothioate.
What is the SMILES notation for (2-oxoethanimidoyl) 3-methylbenzenecarboximidothioate?
The canonical SMILES for (2-oxoethanimidoyl) 3-methylbenzenecarboximidothioate is [H]/N=C(\S/C(C=O)=N/[H])c1cccc(C)c1.
What is the InChIKey of (2-oxoethanimidoyl) 3-methylbenzenecarboximidothioate?
The InChIKey is MINXFZNURHAEON-IXIPZQGVSA-N. The full InChI is InChI=1S/C10H10N2OS/c1-7-3-2-4-8(5-7)10(12)14-9(11)6-13/h2-6,11-12H,1H3/b11-9+,12-10-.
What are the key properties of (2-oxoethanimidoyl) 3-methylbenzenecarboximidothioate?
(2-oxoethanimidoyl) 3-methylbenzenecarboximidothioate has a molecular weight of 206.27 g/mol, XLogP of 2.23, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxoethanimidoyl) 3-methylbenzenecarboximidothioate is sourced from PubChem (CID 178139231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).