About 5-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridine;molecular hydrogen
5-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridine;molecular hydrogen (PubChem CID 178139662) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is 5-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridine;molecular hydrogen.
Molecular Properties
| Compound Name | 5-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridine;molecular hydrogen |
| PubChem CID | 178139662 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 5-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridine;molecular hydrogen |
| SMILES | Cc1ccc2c(n1)NCN2.[H][H].[H][H] |
| InChI | InChI=1S/C7H9N3.2H2/c1-5-2-3-6-7(10-5)9-4-8-6;;/h2-3,8H,4H2,1H3,(H,9,10);2*1H |
| InChIKey | YFHAVLQZOCTGBR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridine;molecular hydrogen?
The IUPAC name of 5-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridine;molecular hydrogen (CID 178139662) is 5-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridine;molecular hydrogen.
What is the SMILES notation for 5-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridine;molecular hydrogen?
The canonical SMILES for 5-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridine;molecular hydrogen is Cc1ccc2c(n1)NCN2.[H][H].[H][H].
What is the InChIKey of 5-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridine;molecular hydrogen?
The InChIKey is YFHAVLQZOCTGBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3.2H2/c1-5-2-3-6-7(10-5)9-4-8-6;;/h2-3,8H,4H2,1H3,(H,9,10);2*1H.
What are the key properties of 5-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridine;molecular hydrogen?
5-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridine;molecular hydrogen has a molecular weight of 139.20 g/mol, XLogP of 1.68, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridine;molecular hydrogen is sourced from PubChem (CID 178139662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).