C20H25F3N4O4 — CID 178140760
formic acid;3-(methoxymethyl)-2-[4-methyl-6-(piperidin-3-ylamino)pyridazin-3-yl]-5-(trifluoromethyl)phenol (PubChem CID 178140760) has the molecular formula C20H25F3N4O4 and a molecular weight of 442.44 g/mol. Its IUPAC name is formic acid;3-(methoxymethyl)-2-[4-methyl-6-(piperidin-3-ylamino)pyridazin-3-yl]-5-(trifluoromethyl)phenol.
| Compound Name | formic acid;3-(methoxymethyl)-2-[4-methyl-6-(piperidin-3-ylamino)pyridazin-3-yl]-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 178140760 |
| Molecular Formula | C20H25F3N4O4 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | formic acid;3-(methoxymethyl)-2-[4-methyl-6-(piperidin-3-ylamino)pyridazin-3-yl]-5-(trifluoromethyl)phenol |
| SMILES | COCc1cc(C(F)(F)F)cc(O)c1-c1nnc(NC2CCCNC2)cc1C.O=CO |
| InChI | InChI=1S/C19H23F3N4O2.CH2O2/c1-11-6-16(24-14-4-3-5-23-9-14)25-26-18(11)17-12(10-28-2)7-13(8-15(17)27)19(20,21)22;2-1-3/h6-8,14,23,27H,3-5,9-10H2,1-2H3,(H,24,25);1H,(H,2,3) |
| InChIKey | UDBROIUMPBZIDZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 116.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|