C21H27F3N6O3 — CID 178140860
formamide;6-[2-methoxy-4-(trifluoromethyl)phenyl]-N,5-dimethyl-3-(piperidin-3-ylamino)pyridazine-4-carboxamide (PubChem CID 178140860) has the molecular formula C21H27F3N6O3 and a molecular weight of 468.48 g/mol. Its IUPAC name is formamide;6-[2-methoxy-4-(trifluoromethyl)phenyl]-N,5-dimethyl-3-(piperidin-3-ylamino)pyridazine-4-carboxamide.
| Compound Name | formamide;6-[2-methoxy-4-(trifluoromethyl)phenyl]-N,5-dimethyl-3-(piperidin-3-ylamino)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 178140860 |
| Molecular Formula | C21H27F3N6O3 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | formamide;6-[2-methoxy-4-(trifluoromethyl)phenyl]-N,5-dimethyl-3-(piperidin-3-ylamino)pyridazine-4-carboxamide |
| SMILES | CNC(=O)c1c(NC2CCCNC2)nnc(-c2ccc(C(F)(F)F)cc2OC)c1C.NC=O |
| InChI | InChI=1S/C20H24F3N5O2.CH3NO/c1-11-16(19(29)24-2)18(26-13-5-4-8-25-10-13)28-27-17(11)14-7-6-12(20(21,22)23)9-15(14)30-3;2-1-3/h6-7,9,13,25H,4-5,8,10H2,1-3H3,(H,24,29)(H,26,28);1H,(H2,2,3) |
| InChIKey | VJBZQRXEADKIOQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|