C18H20ClFO2 — CID 178141229
[5-[(2-chloro-6-fluorophenyl)methoxy]-2-(2-methylpropyl)phenyl]methanol (PubChem CID 178141229) has the molecular formula C18H20ClFO2 and a molecular weight of 322.81 g/mol. Its IUPAC name is [5-[(2-chloro-6-fluorophenyl)methoxy]-2-(2-methylpropyl)phenyl]methanol.
| Compound Name | [5-[(2-chloro-6-fluorophenyl)methoxy]-2-(2-methylpropyl)phenyl]methanol |
|---|---|
| PubChem CID | 178141229 |
| Molecular Formula | C18H20ClFO2 |
| Molecular Weight | 322.81 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | [5-[(2-chloro-6-fluorophenyl)methoxy]-2-(2-methylpropyl)phenyl]methanol |
| SMILES | CC(C)Cc1ccc(OCc2c(F)cccc2Cl)cc1CO |
| InChI | InChI=1S/C18H20ClFO2/c1-12(2)8-13-6-7-15(9-14(13)10-21)22-11-16-17(19)4-3-5-18(16)20/h3-7,9,12,21H,8,10-11H2,1-2H3 |
| InChIKey | HMUVKQNAQVEXKJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.81 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |