About 1-chloro-3-fluoro-2-[(1R,3S)-3-(2-methylpropyl)cyclopentyl]oxybenzene
1-chloro-3-fluoro-2-[(1R,3S)-3-(2-methylpropyl)cyclopentyl]oxybenzene (PubChem CID 178141378) has the molecular formula C15H20ClFO
and a molecular weight of 270.77 g/mol. Its IUPAC name is 1-chloro-3-fluoro-2-[(1R,3S)-3-(2-methylpropyl)cyclopentyl]oxybenzene.
Molecular Properties
| Compound Name | 1-chloro-3-fluoro-2-[(1R,3S)-3-(2-methylpropyl)cyclopentyl]oxybenzene |
| PubChem CID | 178141378 |
| Molecular Formula | C15H20ClFO |
| Molecular Weight | 270.77 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 1-chloro-3-fluoro-2-[(1R,3S)-3-(2-methylpropyl)cyclopentyl]oxybenzene |
| SMILES | CC(C)C[C@@H]1CC[C@@H](Oc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C15H20ClFO/c1-10(2)8-11-6-7-12(9-11)18-15-13(16)4-3-5-14(15)17/h3-5,10-12H,6-9H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | BBBIYZPSQQSYKQ-NWDGAFQWSA-N |
| XLogP | 5.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.77 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-chloro-3-fluoro-2-[(1R,3S)-3-(2-methylpropyl)cyclopentyl]oxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-fluoro-2-[(1R,3S)-3-(2-methylpropyl)cyclopentyl]oxybenzene?
The IUPAC name of 1-chloro-3-fluoro-2-[(1R,3S)-3-(2-methylpropyl)cyclopentyl]oxybenzene (CID 178141378) is 1-chloro-3-fluoro-2-[(1R,3S)-3-(2-methylpropyl)cyclopentyl]oxybenzene.
What is the SMILES notation for 1-chloro-3-fluoro-2-[(1R,3S)-3-(2-methylpropyl)cyclopentyl]oxybenzene?
The canonical SMILES for 1-chloro-3-fluoro-2-[(1R,3S)-3-(2-methylpropyl)cyclopentyl]oxybenzene is CC(C)C[C@@H]1CC[C@@H](Oc2c(F)cccc2Cl)C1.
What is the InChIKey of 1-chloro-3-fluoro-2-[(1R,3S)-3-(2-methylpropyl)cyclopentyl]oxybenzene?
The InChIKey is BBBIYZPSQQSYKQ-NWDGAFQWSA-N. The full InChI is InChI=1S/C15H20ClFO/c1-10(2)8-11-6-7-12(9-11)18-15-13(16)4-3-5-14(15)17/h3-5,10-12H,6-9H2,1-2H3/t11-,12+/m0/s1.
What are the key properties of 1-chloro-3-fluoro-2-[(1R,3S)-3-(2-methylpropyl)cyclopentyl]oxybenzene?
1-chloro-3-fluoro-2-[(1R,3S)-3-(2-methylpropyl)cyclopentyl]oxybenzene has a molecular weight of 270.77 g/mol, XLogP of 5.07, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-fluoro-2-[(1R,3S)-3-(2-methylpropyl)cyclopentyl]oxybenzene is sourced from PubChem (CID 178141378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).