C30H35FN6O3 — CID 178141699
1-[2-[6-[[4-[(1R,2S)-2-fluorocyclohexyl]oxyphenyl]methyl]-7,7-dimethyl-5H-pyrrolo[3,4-b]pyridin-2-yl]-3-methylimidazol-4-yl]-1,3-diazinane-2,4-dione (PubChem CID 178141699) has the molecular formula C30H35FN6O3 and a molecular weight of 546.65 g/mol. Its IUPAC name is 1-[2-[6-[[4-[(1R,2S)-2-fluorocyclohexyl]oxyphenyl]methyl]-7,7-dimethyl-5H-pyrrolo[3,4-b]pyridin-2-yl]-3-methylimidazol-4-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[2-[6-[[4-[(1R,2S)-2-fluorocyclohexyl]oxyphenyl]methyl]-7,7-dimethyl-5H-pyrrolo[3,4-b]pyridin-2-yl]-3-methylimidazol-4-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 178141699 |
| Molecular Formula | C30H35FN6O3 |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | 1-[2-[6-[[4-[(1R,2S)-2-fluorocyclohexyl]oxyphenyl]methyl]-7,7-dimethyl-5H-pyrrolo[3,4-b]pyridin-2-yl]-3-methylimidazol-4-yl]-1,3-diazinane-2,4-dione |
| SMILES | Cn1c(N2CCC(=O)NC2=O)cnc1-c1ccc2c(n1)C(C)(C)N(Cc1ccc(O[C@@H]3CCCC[C@@H]3F)cc1)C2 |
| InChI | InChI=1S/C30H35FN6O3/c1-30(2)27-20(18-36(30)17-19-8-11-21(12-9-19)40-24-7-5-4-6-22(24)31)10-13-23(33-27)28-32-16-26(35(28)3)37-15-14-25(38)34-29(37)39/h8-13,16,22,24H,4-7,14-15,17-18H2,1-3H3,(H,34,38,39)/t22-,24+/m0/s1 |
| InChIKey | VLSRZAIAGHYHOY-LADGPHEKSA-N |
| XLogP | 4.84 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |