C13H19F3N4O — CID 178142897
1-methyl-5-[1-[2-(3,3,3-trifluoropropoxy)ethyl]-1,2,4-triazol-3-yl]-3,6-dihydro-2H-pyridine (PubChem CID 178142897) has the molecular formula C13H19F3N4O and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-methyl-5-[1-[2-(3,3,3-trifluoropropoxy)ethyl]-1,2,4-triazol-3-yl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-methyl-5-[1-[2-(3,3,3-trifluoropropoxy)ethyl]-1,2,4-triazol-3-yl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 178142897 |
| Molecular Formula | C13H19F3N4O |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-methyl-5-[1-[2-(3,3,3-trifluoropropoxy)ethyl]-1,2,4-triazol-3-yl]-3,6-dihydro-2H-pyridine |
| SMILES | CN1CCC=C(c2ncn(CCOCCC(F)(F)F)n2)C1 |
| InChI | InChI=1S/C13H19F3N4O/c1-19-5-2-3-11(9-19)12-17-10-20(18-12)6-8-21-7-4-13(14,15)16/h3,10H,2,4-9H2,1H3 |
| InChIKey | QXQVYHYOXOXITG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|