About 1-benzylpyrrolidine;propan-2-ol;1,1,1-trifluoroethane
1-benzylpyrrolidine;propan-2-ol;1,1,1-trifluoroethane (PubChem CID 178143402) has the molecular formula C16H26F3NO
and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-benzylpyrrolidine;propan-2-ol;1,1,1-trifluoroethane.
Molecular Properties
| Compound Name | 1-benzylpyrrolidine;propan-2-ol;1,1,1-trifluoroethane |
| PubChem CID | 178143402 |
| Molecular Formula | C16H26F3NO |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 1-benzylpyrrolidine;propan-2-ol;1,1,1-trifluoroethane |
| SMILES | CC(C)O.CC(F)(F)F.c1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C11H15N.C3H8O.C2H3F3/c1-2-6-11(7-3-1)10-12-8-4-5-9-12;1-3(2)4;1-2(3,4)5/h1-3,6-7H,4-5,8-10H2;3-4H,1-2H3;1H3 |
| InChIKey | AOOPUJHPOIZKPO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzylpyrrolidine;propan-2-ol;1,1,1-trifluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpyrrolidine;propan-2-ol;1,1,1-trifluoroethane?
The IUPAC name of 1-benzylpyrrolidine;propan-2-ol;1,1,1-trifluoroethane (CID 178143402) is 1-benzylpyrrolidine;propan-2-ol;1,1,1-trifluoroethane.
What is the SMILES notation for 1-benzylpyrrolidine;propan-2-ol;1,1,1-trifluoroethane?
The canonical SMILES for 1-benzylpyrrolidine;propan-2-ol;1,1,1-trifluoroethane is CC(C)O.CC(F)(F)F.c1ccc(CN2CCCC2)cc1.
What is the InChIKey of 1-benzylpyrrolidine;propan-2-ol;1,1,1-trifluoroethane?
The InChIKey is AOOPUJHPOIZKPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C3H8O.C2H3F3/c1-2-6-11(7-3-1)10-12-8-4-5-9-12;1-3(2)4;1-2(3,4)5/h1-3,6-7H,4-5,8-10H2;3-4H,1-2H3;1H3.
What are the key properties of 1-benzylpyrrolidine;propan-2-ol;1,1,1-trifluoroethane?
1-benzylpyrrolidine;propan-2-ol;1,1,1-trifluoroethane has a molecular weight of 305.38 g/mol, XLogP of 4.24, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpyrrolidine;propan-2-ol;1,1,1-trifluoroethane is sourced from PubChem (CID 178143402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).