C21H23NO — CID 178143439
(3aR,7aR)-1-benzhydryl-3,3a,5,6,7,7a-hexahydro-2H-indol-4-one (PubChem CID 178143439) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is (3aR,7aR)-1-benzhydryl-3,3a,5,6,7,7a-hexahydro-2H-indol-4-one.
| Compound Name | (3aR,7aR)-1-benzhydryl-3,3a,5,6,7,7a-hexahydro-2H-indol-4-one |
|---|---|
| PubChem CID | 178143439 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (3aR,7aR)-1-benzhydryl-3,3a,5,6,7,7a-hexahydro-2H-indol-4-one |
| SMILES | O=C1CCC[C@@H]2[C@H]1CCN2C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO/c23-20-13-7-12-19-18(20)14-15-22(19)21(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-6,8-11,18-19,21H,7,12-15H2/t18-,19-/m1/s1 |
| InChIKey | QZETWDIWXILXJO-RTBURBONSA-N |
| XLogP | 4.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |