About methyl 2-oxo-2-[[3-(2,2,2-trifluoroethyl)imidazol-4-yl]methylamino]acetate
methyl 2-oxo-2-[[3-(2,2,2-trifluoroethyl)imidazol-4-yl]methylamino]acetate (PubChem CID 178143906) has the molecular formula C9H10F3N3O3
and a molecular weight of 265.19 g/mol. Its IUPAC name is methyl 2-oxo-2-[[3-(2,2,2-trifluoroethyl)imidazol-4-yl]methylamino]acetate.
Molecular Properties
| Compound Name | methyl 2-oxo-2-[[3-(2,2,2-trifluoroethyl)imidazol-4-yl]methylamino]acetate |
| PubChem CID | 178143906 |
| Molecular Formula | C9H10F3N3O3 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | methyl 2-oxo-2-[[3-(2,2,2-trifluoroethyl)imidazol-4-yl]methylamino]acetate |
| SMILES | COC(=O)C(=O)NCc1cncn1CC(F)(F)F |
| InChI | InChI=1S/C9H10F3N3O3/c1-18-8(17)7(16)14-3-6-2-13-5-15(6)4-9(10,11)12/h2,5H,3-4H2,1H3,(H,14,16) |
| InChIKey | DQOQKCLNXSMQED-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-oxo-2-[[3-(2,2,2-trifluoroethyl)imidazol-4-yl]methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-oxo-2-[[3-(2,2,2-trifluoroethyl)imidazol-4-yl]methylamino]acetate?
The IUPAC name of methyl 2-oxo-2-[[3-(2,2,2-trifluoroethyl)imidazol-4-yl]methylamino]acetate (CID 178143906) is methyl 2-oxo-2-[[3-(2,2,2-trifluoroethyl)imidazol-4-yl]methylamino]acetate.
What is the SMILES notation for methyl 2-oxo-2-[[3-(2,2,2-trifluoroethyl)imidazol-4-yl]methylamino]acetate?
The canonical SMILES for methyl 2-oxo-2-[[3-(2,2,2-trifluoroethyl)imidazol-4-yl]methylamino]acetate is COC(=O)C(=O)NCc1cncn1CC(F)(F)F.
What is the InChIKey of methyl 2-oxo-2-[[3-(2,2,2-trifluoroethyl)imidazol-4-yl]methylamino]acetate?
The InChIKey is DQOQKCLNXSMQED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3N3O3/c1-18-8(17)7(16)14-3-6-2-13-5-15(6)4-9(10,11)12/h2,5H,3-4H2,1H3,(H,14,16).
What are the key properties of methyl 2-oxo-2-[[3-(2,2,2-trifluoroethyl)imidazol-4-yl]methylamino]acetate?
methyl 2-oxo-2-[[3-(2,2,2-trifluoroethyl)imidazol-4-yl]methylamino]acetate has a molecular weight of 265.19 g/mol, XLogP of 0.23, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-oxo-2-[[3-(2,2,2-trifluoroethyl)imidazol-4-yl]methylamino]acetate is sourced from PubChem (CID 178143906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).