C17H13F3N4O2S — CID 178144375
5-benzylsulfanyl-N'-(2,2-difluoroacetyl)-7-fluoropyrazolo[1,5-a]pyridine-3-carbohydrazide (PubChem CID 178144375) has the molecular formula C17H13F3N4O2S and a molecular weight of 394.38 g/mol. Its IUPAC name is 5-benzylsulfanyl-N'-(2,2-difluoroacetyl)-7-fluoropyrazolo[1,5-a]pyridine-3-carbohydrazide.
| Compound Name | 5-benzylsulfanyl-N'-(2,2-difluoroacetyl)-7-fluoropyrazolo[1,5-a]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 178144375 |
| Molecular Formula | C17H13F3N4O2S |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 5-benzylsulfanyl-N'-(2,2-difluoroacetyl)-7-fluoropyrazolo[1,5-a]pyridine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C(F)F)c1cnn2c(F)cc(SCc3ccccc3)cc12 |
| InChI | InChI=1S/C17H13F3N4O2S/c18-14-7-11(27-9-10-4-2-1-3-5-10)6-13-12(8-21-24(13)14)16(25)22-23-17(26)15(19)20/h1-8,15H,9H2,(H,22,25)(H,23,26) |
| InChIKey | WOYYNZJMYMPCCJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|