C17H11F3N4SSe — CID 178144589
2-(5-benzylsulfanyl-7-fluoropyrazolo[1,5-a]pyridin-3-yl)-5-(difluoromethyl)-1,3,4-selenadiazole (PubChem CID 178144589) has the molecular formula C17H11F3N4SSe and a molecular weight of 439.32 g/mol. Its IUPAC name is 2-(5-benzylsulfanyl-7-fluoropyrazolo[1,5-a]pyridin-3-yl)-5-(difluoromethyl)-1,3,4-selenadiazole.
| Compound Name | 2-(5-benzylsulfanyl-7-fluoropyrazolo[1,5-a]pyridin-3-yl)-5-(difluoromethyl)-1,3,4-selenadiazole |
|---|---|
| PubChem CID | 178144589 |
| Molecular Formula | C17H11F3N4SSe |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | 2-(5-benzylsulfanyl-7-fluoropyrazolo[1,5-a]pyridin-3-yl)-5-(difluoromethyl)-1,3,4-selenadiazole |
| SMILES | Fc1cc(SCc2ccccc2)cc2c(-c3nnc(C(F)F)[se]3)cnn12 |
| InChI | InChI=1S/C17H11F3N4SSe/c18-14-7-11(25-9-10-4-2-1-3-5-10)6-13-12(8-21-24(13)14)16-22-23-17(26-16)15(19)20/h1-8,15H,9H2 |
| InChIKey | CNXCFNBHNAHSTI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|