C20H24F3N7O2S2 — CID 178144776
3-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-8-[(3S,5S)-3,5-dimethylpiperazin-1-yl]-2-fluoro-N-(1-methylcyclopropyl)imidazo[1,2-a]pyridine-6-sulfonamide (PubChem CID 178144776) has the molecular formula C20H24F3N7O2S2 and a molecular weight of 515.59 g/mol. Its IUPAC name is 3-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-8-[(3S,5S)-3,5-dimethylpiperazin-1-yl]-2-fluoro-N-(1-methylcyclopropyl)imidazo[1,2-a]pyridine-6-sulfonamide.
| Compound Name | 3-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-8-[(3S,5S)-3,5-dimethylpiperazin-1-yl]-2-fluoro-N-(1-methylcyclopropyl)imidazo[1,2-a]pyridine-6-sulfonamide |
|---|---|
| PubChem CID | 178144776 |
| Molecular Formula | C20H24F3N7O2S2 |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | 3-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-8-[(3S,5S)-3,5-dimethylpiperazin-1-yl]-2-fluoro-N-(1-methylcyclopropyl)imidazo[1,2-a]pyridine-6-sulfonamide |
| SMILES | C[C@H]1CN(c2cc(S(=O)(=O)NC3(C)CC3)cn3c(-c4nnc(C(F)F)s4)c(F)nc23)C[C@H](C)N1 |
| InChI | InChI=1S/C20H24F3N7O2S2/c1-10-7-29(8-11(2)24-10)13-6-12(34(31,32)28-20(3)4-5-20)9-30-14(16(23)25-17(13)30)18-26-27-19(33-18)15(21)22/h6,9-11,15,24,28H,4-5,7-8H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | NEXTWWKKEYDLQR-QWRGUYRKSA-N |
| XLogP | 2.95 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |