C19H23N2O3+ — CID 178144846
tert-butyl 4-(1-hydroxyquinolin-1-ium-3-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 178144846) has the molecular formula C19H23N2O3+ and a molecular weight of 327.40 g/mol. Its IUPAC name is tert-butyl 4-(1-hydroxyquinolin-1-ium-3-yl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-(1-hydroxyquinolin-1-ium-3-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 178144846 |
| Molecular Formula | C19H23N2O3+ |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | tert-butyl 4-(1-hydroxyquinolin-1-ium-3-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2cc3ccccc3[n+](O)c2)CC1 |
| InChI | InChI=1S/C19H23N2O3/c1-19(2,3)24-18(22)20-10-8-14(9-11-20)16-12-15-6-4-5-7-17(15)21(23)13-16/h4-8,12-13,23H,9-11H2,1-3H3/q+1 |
| InChIKey | REEDVFBVGHERTE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|