C17H22N2O4 — CID 178145170
tert-butyl 2-benzoyloxy-2,6-diazaspiro[3.3]heptane-6-carboxylate (PubChem CID 178145170) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is tert-butyl 2-benzoyloxy-2,6-diazaspiro[3.3]heptane-6-carboxylate.
| Compound Name | tert-butyl 2-benzoyloxy-2,6-diazaspiro[3.3]heptane-6-carboxylate |
|---|---|
| PubChem CID | 178145170 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | tert-butyl 2-benzoyloxy-2,6-diazaspiro[3.3]heptane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CN(OC(=O)c3ccccc3)C2)C1 |
| InChI | InChI=1S/C17H22N2O4/c1-16(2,3)22-15(21)18-9-17(10-18)11-19(12-17)23-14(20)13-7-5-4-6-8-13/h4-8H,9-12H2,1-3H3 |
| InChIKey | QZSLSVCSJSVCLT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |