About N-(4,4-difluorocyclohexyl)-5-(ethylaminomethyl)-2-methylsulfanylpyrimidin-4-amine
N-(4,4-difluorocyclohexyl)-5-(ethylaminomethyl)-2-methylsulfanylpyrimidin-4-amine (PubChem CID 178145750) has the molecular formula C14H22F2N4S
and a molecular weight of 316.42 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-5-(ethylaminomethyl)-2-methylsulfanylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(4,4-difluorocyclohexyl)-5-(ethylaminomethyl)-2-methylsulfanylpyrimidin-4-amine |
| PubChem CID | 178145750 |
| Molecular Formula | C14H22F2N4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-5-(ethylaminomethyl)-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CCNCc1cnc(SC)nc1NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H22F2N4S/c1-3-17-8-10-9-18-13(21-2)20-12(10)19-11-4-6-14(15,16)7-5-11/h9,11,17H,3-8H2,1-2H3,(H,18,19,20) |
| InChIKey | JTRFGDWVPKLSBR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4,4-difluorocyclohexyl)-5-(ethylaminomethyl)-2-methylsulfanylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-difluorocyclohexyl)-5-(ethylaminomethyl)-2-methylsulfanylpyrimidin-4-amine?
The IUPAC name of N-(4,4-difluorocyclohexyl)-5-(ethylaminomethyl)-2-methylsulfanylpyrimidin-4-amine (CID 178145750) is N-(4,4-difluorocyclohexyl)-5-(ethylaminomethyl)-2-methylsulfanylpyrimidin-4-amine.
What is the SMILES notation for N-(4,4-difluorocyclohexyl)-5-(ethylaminomethyl)-2-methylsulfanylpyrimidin-4-amine?
The canonical SMILES for N-(4,4-difluorocyclohexyl)-5-(ethylaminomethyl)-2-methylsulfanylpyrimidin-4-amine is CCNCc1cnc(SC)nc1NC1CCC(F)(F)CC1.
What is the InChIKey of N-(4,4-difluorocyclohexyl)-5-(ethylaminomethyl)-2-methylsulfanylpyrimidin-4-amine?
The InChIKey is JTRFGDWVPKLSBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F2N4S/c1-3-17-8-10-9-18-13(21-2)20-12(10)19-11-4-6-14(15,16)7-5-11/h9,11,17H,3-8H2,1-2H3,(H,18,19,20).
What are the key properties of N-(4,4-difluorocyclohexyl)-5-(ethylaminomethyl)-2-methylsulfanylpyrimidin-4-amine?
N-(4,4-difluorocyclohexyl)-5-(ethylaminomethyl)-2-methylsulfanylpyrimidin-4-amine has a molecular weight of 316.42 g/mol, XLogP of 3.30, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-difluorocyclohexyl)-5-(ethylaminomethyl)-2-methylsulfanylpyrimidin-4-amine is sourced from PubChem (CID 178145750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).