C18H18Cl2N6O2 — CID 178146534
3,5-dichloro-2-hydroxy-N-[1-(9-methylpurin-2-yl)piperidin-4-yl]benzamide (PubChem CID 178146534) has the molecular formula C18H18Cl2N6O2 and a molecular weight of 421.29 g/mol. Its IUPAC name is 3,5-dichloro-2-hydroxy-N-[1-(9-methylpurin-2-yl)piperidin-4-yl]benzamide.
| Compound Name | 3,5-dichloro-2-hydroxy-N-[1-(9-methylpurin-2-yl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 178146534 |
| Molecular Formula | C18H18Cl2N6O2 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 3,5-dichloro-2-hydroxy-N-[1-(9-methylpurin-2-yl)piperidin-4-yl]benzamide |
| SMILES | Cn1cnc2cnc(N3CCC(NC(=O)c4cc(Cl)cc(Cl)c4O)CC3)nc21 |
| InChI | InChI=1S/C18H18Cl2N6O2/c1-25-9-22-14-8-21-18(24-16(14)25)26-4-2-11(3-5-26)23-17(28)12-6-10(19)7-13(20)15(12)27/h6-9,11,27H,2-5H2,1H3,(H,23,28) |
| InChIKey | DZIAZIWQIQGAAM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |