C30H38N2O8 — CID 178146646
5-[(2E)-7-ethenyl-6,7,10,11-tetrahydroxy-3,11-dimethyltrideca-2,12-dienyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one (PubChem CID 178146646) has the molecular formula C30H38N2O8 and a molecular weight of 554.64 g/mol. Its IUPAC name is 5-[(2E)-7-ethenyl-6,7,10,11-tetrahydroxy-3,11-dimethyltrideca-2,12-dienyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 5-[(2E)-7-ethenyl-6,7,10,11-tetrahydroxy-3,11-dimethyltrideca-2,12-dienyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 178146646 |
| Molecular Formula | C30H38N2O8 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 5-[(2E)-7-ethenyl-6,7,10,11-tetrahydroxy-3,11-dimethyltrideca-2,12-dienyl]-1,3,10-trihydroxy-11H-benzo[b][1,4]benzodiazepin-6-one |
| SMILES | C=CC(C)(O)C(O)CCC(O)(C=C)C(O)CC/C(C)=C/CN1C(=O)c2cccc(O)c2Nc2c(O)cc(O)cc21 |
| InChI | InChI=1S/C30H38N2O8/c1-5-29(4,39)24(36)12-14-30(40,6-2)25(37)11-10-18(3)13-15-32-21-16-19(33)17-23(35)27(21)31-26-20(28(32)38)8-7-9-22(26)34/h5-9,13,16-17,24-25,31,33-37,39-40H,1-2,10-12,14-15H2,3-4H3/b18-13+ |
| InChIKey | KBRUNNGNNZJNDP-QGOAFFKASA-N |
| XLogP | 3.59 |
| TPSA | 173.95 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|