About 1-ethyl-1-piperidin-4-ylhydrazine;2-methylidenebutanenitrile
1-ethyl-1-piperidin-4-ylhydrazine;2-methylidenebutanenitrile (PubChem CID 178146708) has the molecular formula C12H24N4
and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-ethyl-1-piperidin-4-ylhydrazine;2-methylidenebutanenitrile.
Molecular Properties
| Compound Name | 1-ethyl-1-piperidin-4-ylhydrazine;2-methylidenebutanenitrile |
| PubChem CID | 178146708 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | 1-ethyl-1-piperidin-4-ylhydrazine;2-methylidenebutanenitrile |
| SMILES | C=C(C#N)CC.CCN(N)C1CCNCC1 |
| InChI | InChI=1S/C7H17N3.C5H7N/c1-2-10(8)7-3-5-9-6-4-7;1-3-5(2)4-6/h7,9H,2-6,8H2,1H3;2-3H2,1H3 |
| InChIKey | GMGPZDZYHOMNJY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 65.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-piperidin-4-ylhydrazine;2-methylidenebutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-piperidin-4-ylhydrazine;2-methylidenebutanenitrile?
The IUPAC name of 1-ethyl-1-piperidin-4-ylhydrazine;2-methylidenebutanenitrile (CID 178146708) is 1-ethyl-1-piperidin-4-ylhydrazine;2-methylidenebutanenitrile.
What is the SMILES notation for 1-ethyl-1-piperidin-4-ylhydrazine;2-methylidenebutanenitrile?
The canonical SMILES for 1-ethyl-1-piperidin-4-ylhydrazine;2-methylidenebutanenitrile is C=C(C#N)CC.CCN(N)C1CCNCC1.
What is the InChIKey of 1-ethyl-1-piperidin-4-ylhydrazine;2-methylidenebutanenitrile?
The InChIKey is GMGPZDZYHOMNJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3.C5H7N/c1-2-10(8)7-3-5-9-6-4-7;1-3-5(2)4-6/h7,9H,2-6,8H2,1H3;2-3H2,1H3.
What are the key properties of 1-ethyl-1-piperidin-4-ylhydrazine;2-methylidenebutanenitrile?
1-ethyl-1-piperidin-4-ylhydrazine;2-methylidenebutanenitrile has a molecular weight of 224.35 g/mol, XLogP of 1.41, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-piperidin-4-ylhydrazine;2-methylidenebutanenitrile is sourced from PubChem (CID 178146708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).