C12H12ClNO2 — CID 178146743
4-(4-chloro-2-methylphenyl)-3,4-dihydroxy-2-methylidenebutanenitrile (PubChem CID 178146743) has the molecular formula C12H12ClNO2 and a molecular weight of 237.69 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenyl)-3,4-dihydroxy-2-methylidenebutanenitrile.
| Compound Name | 4-(4-chloro-2-methylphenyl)-3,4-dihydroxy-2-methylidenebutanenitrile |
|---|---|
| PubChem CID | 178146743 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 4-(4-chloro-2-methylphenyl)-3,4-dihydroxy-2-methylidenebutanenitrile |
| SMILES | C=C(C#N)C(O)C(O)c1ccc(Cl)cc1C |
| InChI | InChI=1S/C12H12ClNO2/c1-7-5-9(13)3-4-10(7)12(16)11(15)8(2)6-14/h3-5,11-12,15-16H,2H2,1H3 |
| InChIKey | YSOZCGVEVBFKKD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|