C27H40F2N10O4 — CID 178147371
N-[2-[3-[(5-ethoxypyrazin-2-yl)carbamoyl-methylamino]-4,4-difluoropiperidin-1-yl]pyrimidin-4-yl]formamide;7-methoxy-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 178147371) has the molecular formula C27H40F2N10O4 and a molecular weight of 606.68 g/mol. Its IUPAC name is N-[2-[3-[(5-ethoxypyrazin-2-yl)carbamoyl-methylamino]-4,4-difluoropiperidin-1-yl]pyrimidin-4-yl]formamide;7-methoxy-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | N-[2-[3-[(5-ethoxypyrazin-2-yl)carbamoyl-methylamino]-4,4-difluoropiperidin-1-yl]pyrimidin-4-yl]formamide;7-methoxy-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 178147371 |
| Molecular Formula | C27H40F2N10O4 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | N-[2-[3-[(5-ethoxypyrazin-2-yl)carbamoyl-methylamino]-4,4-difluoropiperidin-1-yl]pyrimidin-4-yl]formamide;7-methoxy-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CCOc1cnc(NC(=O)N(C)C2CN(c3nccc(NC=O)n3)CCC2(F)F)cn1.COC1CC2CN(C)CCN2C1 |
| InChI | InChI=1S/C18H22F2N8O3.C9H18N2O/c1-3-31-15-9-22-14(8-23-15)26-17(30)27(2)12-10-28(7-5-18(12,19)20)16-21-6-4-13(25-16)24-11-29;1-10-3-4-11-7-9(12-2)5-8(11)6-10/h4,6,8-9,11-12H,3,5,7,10H2,1-2H3,(H,22,26,30)(H,21,24,25,29);8-9H,3-7H2,1-2H3 |
| InChIKey | UDQYDNDJWDQQQE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 141.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|