C11H17N3O2P+ — CID 178148251
[(1,3-dimethylbenzimidazol-2-ylidene)amino]-hydroxy-methoxy-methylphosphanium (PubChem CID 178148251) has the molecular formula C11H17N3O2P+ and a molecular weight of 254.25 g/mol. Its IUPAC name is [(1,3-dimethylbenzimidazol-2-ylidene)amino]-hydroxy-methoxy-methylphosphanium.
| Compound Name | [(1,3-dimethylbenzimidazol-2-ylidene)amino]-hydroxy-methoxy-methylphosphanium |
|---|---|
| PubChem CID | 178148251 |
| Molecular Formula | C11H17N3O2P+ |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | [(1,3-dimethylbenzimidazol-2-ylidene)amino]-hydroxy-methoxy-methylphosphanium |
| SMILES | CO[P+](C)(O)N=c1n(C)c2ccccc2n1C |
| InChI | InChI=1S/C11H17N3O2P/c1-13-9-7-5-6-8-10(9)14(2)11(13)12-17(4,15)16-3/h5-8,15H,1-4H3/q+1 |
| InChIKey | SSPHHEKOEUWQAB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 51.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|