C29H29ClF3N5O3 — CID 178148301
3-[(2-chlorophenyl)methylamino]-4-[2-[[(4-ethylbenzenecarboximidoyl)-(3,3,3-trifluoropropyl)carbamoyl]amino]ethanimidoyl]benzoic acid (PubChem CID 178148301) has the molecular formula C29H29ClF3N5O3 and a molecular weight of 588.03 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methylamino]-4-[2-[[(4-ethylbenzenecarboximidoyl)-(3,3,3-trifluoropropyl)carbamoyl]amino]ethanimidoyl]benzoic acid.
| Compound Name | 3-[(2-chlorophenyl)methylamino]-4-[2-[[(4-ethylbenzenecarboximidoyl)-(3,3,3-trifluoropropyl)carbamoyl]amino]ethanimidoyl]benzoic acid |
|---|---|
| PubChem CID | 178148301 |
| Molecular Formula | C29H29ClF3N5O3 |
| Molecular Weight | 588.03 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | 3-[(2-chlorophenyl)methylamino]-4-[2-[[(4-ethylbenzenecarboximidoyl)-(3,3,3-trifluoropropyl)carbamoyl]amino]ethanimidoyl]benzoic acid |
| SMILES | [H]/N=C(\CNC(=O)N(CCC(F)(F)F)/C(=N/[H])c1ccc(CC)cc1)c1ccc(C(=O)O)cc1NCc1ccccc1Cl |
| InChI | InChI=1S/C29H29ClF3N5O3/c1-2-18-7-9-19(10-8-18)26(35)38(14-13-29(31,32)33)28(41)37-17-24(34)22-12-11-20(27(39)40)15-25(22)36-16-21-5-3-4-6-23(21)30/h3-12,15,34-36H,2,13-14,16-17H2,1H3,(H,37,41)(H,39,40)/b34-24+,35-26+ |
| InChIKey | OJQUXGDGPQYOSY-ULYZEGELSA-N |
| XLogP | 6.57 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.03 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|