About CID 178148328
CID 178148328 (PubChem CID 178148328) has the molecular formula C31H30ClF4IN5O2-
and a molecular weight of 742.96 g/mol.
Molecular Properties
| Compound Name | CID 178148328 |
| PubChem CID | 178148328 |
| Molecular Formula | C31H30ClF4IN5O2- |
| Molecular Weight | 742.96 g/mol |
| Exact Mass | 742.11 |
| IUPAC Name | — |
| SMILES | C=C(C)C1(F)CCc2c(Cn3nc(-c4ccc(C5C[I-]5)cc4)n(C[C@H](O)C(F)(F)F)c3=O)nn(Cc3ccccc3Cl)c2C1 |
| InChI | InChI=1S/C31H30ClF4IN5O2/c1-18(2)30(33)12-11-22-25(38-41(26(22)13-30)15-21-5-3-4-6-23(21)32)16-42-29(44)40(17-27(43)31(34,35)36)28(39-42)20-9-7-19(8-10-20)24-14-37-24/h3-10,24,27,43H,1,11-17H2,2H3/q-1/t24?,27-,30?/m0/s1 |
| InChIKey | UAYDIFZEWJXYRN-ROTRRZJSSA-N |
| XLogP | 2.50 |
| TPSA | 77.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 742.96 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 178148328 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178148328?
The IUPAC name of CID 178148328 (CID 178148328) is not available.
What is the SMILES notation for CID 178148328?
The canonical SMILES for CID 178148328 is C=C(C)C1(F)CCc2c(Cn3nc(-c4ccc(C5C[I-]5)cc4)n(C[C@H](O)C(F)(F)F)c3=O)nn(Cc3ccccc3Cl)c2C1.
What is the InChIKey of CID 178148328?
The InChIKey is UAYDIFZEWJXYRN-ROTRRZJSSA-N. The full InChI is InChI=1S/C31H30ClF4IN5O2/c1-18(2)30(33)12-11-22-25(38-41(26(22)13-30)15-21-5-3-4-6-23(21)32)16-42-29(44)40(17-27(43)31(34,35)36)28(39-42)20-9-7-19(8-10-20)24-14-37-24/h3-10,24,27,43H,1,11-17H2,2H3/q-1/t24?,27-,30?/m0/s1.
What are the key properties of CID 178148328?
CID 178148328 has a molecular weight of 742.96 g/mol, XLogP of 2.50, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178148328 is sourced from PubChem (CID 178148328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).