C12H13F3N2O2 — CID 178148394
N-(4-hydroxybenzenecarboximidoyl)-N-(3,3,3-trifluoropropyl)acetamide (PubChem CID 178148394) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is N-(4-hydroxybenzenecarboximidoyl)-N-(3,3,3-trifluoropropyl)acetamide.
| Compound Name | N-(4-hydroxybenzenecarboximidoyl)-N-(3,3,3-trifluoropropyl)acetamide |
|---|---|
| PubChem CID | 178148394 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N-(4-hydroxybenzenecarboximidoyl)-N-(3,3,3-trifluoropropyl)acetamide |
| SMILES | [H]/N=C(/c1ccc(O)cc1)N(CCC(F)(F)F)C(C)=O |
| InChI | InChI=1S/C12H13F3N2O2/c1-8(18)17(7-6-12(13,14)15)11(16)9-2-4-10(19)5-3-9/h2-5,16,19H,6-7H2,1H3/b16-11- |
| InChIKey | VYEYSESAPKDYEN-WJDWOHSUSA-N |
| XLogP | 2.52 |
| TPSA | 64.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|