C29H36ClF3N6O3 — CID 178148470
N-[(4Z)-4-[1-amino-2-(methylamino)ethylidene]-3-[(2-chlorophenyl)methylimino]cyclohexyl]acetamide;N-(4-hydroxybenzenecarboximidoyl)-N-(3,3,3-trifluoropropyl)formamide (PubChem CID 178148470) has the molecular formula C29H36ClF3N6O3 and a molecular weight of 609.09 g/mol. Its IUPAC name is N-[(4Z)-4-[1-amino-2-(methylamino)ethylidene]-3-[(2-chlorophenyl)methylimino]cyclohexyl]acetamide;N-(4-hydroxybenzenecarboximidoyl)-N-(3,3,3-trifluoropropyl)formamide.
| Compound Name | N-[(4Z)-4-[1-amino-2-(methylamino)ethylidene]-3-[(2-chlorophenyl)methylimino]cyclohexyl]acetamide;N-(4-hydroxybenzenecarboximidoyl)-N-(3,3,3-trifluoropropyl)formamide |
|---|---|
| PubChem CID | 178148470 |
| Molecular Formula | C29H36ClF3N6O3 |
| Molecular Weight | 609.09 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | N-[(4Z)-4-[1-amino-2-(methylamino)ethylidene]-3-[(2-chlorophenyl)methylimino]cyclohexyl]acetamide;N-(4-hydroxybenzenecarboximidoyl)-N-(3,3,3-trifluoropropyl)formamide |
| SMILES | CNC/C(N)=C1\CCC(NC(C)=O)C\C1=N/Cc1ccccc1Cl.[H]/N=C(/c1ccc(O)cc1)N(C=O)CCC(F)(F)F |
| InChI | InChI=1S/C18H25ClN4O.C11H11F3N2O2/c1-12(24)23-14-7-8-15(17(20)11-21-2)18(9-14)22-10-13-5-3-4-6-16(13)19;12-11(13,14)5-6-16(7-17)10(15)8-1-3-9(18)4-2-8/h3-6,14,21H,7-11,20H2,1-2H3,(H,23,24);1-4,7,15,18H,5-6H2/b17-15-,22-18+;15-10- |
| InChIKey | HBTBRIQDEVCSOT-UHKOGQELSA-N |
| XLogP | 4.53 |
| TPSA | 143.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.09 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|