C25H27ClF3N5O3 — CID 178148473
3-[(2Z)-2-amino-2-[2-(3-chlorophenyl)imino-5-hydroxycyclohexylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea (PubChem CID 178148473) has the molecular formula C25H27ClF3N5O3 and a molecular weight of 537.97 g/mol. Its IUPAC name is 3-[(2Z)-2-amino-2-[2-(3-chlorophenyl)imino-5-hydroxycyclohexylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea.
| Compound Name | 3-[(2Z)-2-amino-2-[2-(3-chlorophenyl)imino-5-hydroxycyclohexylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 178148473 |
| Molecular Formula | C25H27ClF3N5O3 |
| Molecular Weight | 537.97 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | 3-[(2Z)-2-amino-2-[2-(3-chlorophenyl)imino-5-hydroxycyclohexylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
| SMILES | [H]/N=C(\c1ccc(O)cc1)N(CCC(F)(F)F)C(=O)NC/C(N)=C1\CC(O)CC\C1=N/c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H27ClF3N5O3/c26-16-2-1-3-17(12-16)33-22-9-8-19(36)13-20(22)21(30)14-32-24(37)34(11-10-25(27,28)29)23(31)15-4-6-18(35)7-5-15/h1-7,12,19,31,35-36H,8-11,13-14,30H2,(H,32,37)/b21-20-,31-23+,33-22+ |
| InChIKey | DXQPGVQXDIJRPF-VCXQIXAQSA-N |
| XLogP | 4.87 |
| TPSA | 135.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.97 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|