C28H37ClF4N6O2 — CID 178148475
3-[2-[5-[(2-chloro-6-fluorophenyl)methylamino]-1,2,3,6-tetrahydropyridin-4-yl]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea;ethane;methanimine (PubChem CID 178148475) has the molecular formula C28H37ClF4N6O2 and a molecular weight of 601.09 g/mol. Its IUPAC name is 3-[2-[5-[(2-chloro-6-fluorophenyl)methylamino]-1,2,3,6-tetrahydropyridin-4-yl]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea;ethane;methanimine.
| Compound Name | 3-[2-[5-[(2-chloro-6-fluorophenyl)methylamino]-1,2,3,6-tetrahydropyridin-4-yl]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea;ethane;methanimine |
|---|---|
| PubChem CID | 178148475 |
| Molecular Formula | C28H37ClF4N6O2 |
| Molecular Weight | 601.09 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | 3-[2-[5-[(2-chloro-6-fluorophenyl)methylamino]-1,2,3,6-tetrahydropyridin-4-yl]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea;ethane;methanimine |
| SMILES | CC.[H]/N=C(\c1ccc(O)cc1)N(CCC(F)(F)F)C(=O)NCCC1=C(NCc2c(F)cccc2Cl)CNCC1.[H]N=C |
| InChI | InChI=1S/C25H28ClF4N5O2.C2H6.CH3N/c26-20-2-1-3-21(27)19(20)14-34-22-15-32-11-8-16(22)9-12-33-24(37)35(13-10-25(28,29)30)23(31)17-4-6-18(36)7-5-17;2*1-2/h1-7,31-32,34,36H,8-15H2,(H,33,37);1-2H3;2H,1H2/b31-23+;; |
| InChIKey | VLRVYSZYOSBUCR-UFKJEFFTSA-N |
| XLogP | 6.19 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.09 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|