C24H25Cl2F3N6O2 — CID 178148550
3-[(2Z)-2-amino-2-[3-(2,3-dichlorophenyl)iminopiperidin-4-ylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea (PubChem CID 178148550) has the molecular formula C24H25Cl2F3N6O2 and a molecular weight of 557.40 g/mol. Its IUPAC name is 3-[(2Z)-2-amino-2-[3-(2,3-dichlorophenyl)iminopiperidin-4-ylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea.
| Compound Name | 3-[(2Z)-2-amino-2-[3-(2,3-dichlorophenyl)iminopiperidin-4-ylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 178148550 |
| Molecular Formula | C24H25Cl2F3N6O2 |
| Molecular Weight | 557.40 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 3-[(2Z)-2-amino-2-[3-(2,3-dichlorophenyl)iminopiperidin-4-ylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
| SMILES | [H]/N=C(\c1ccc(O)cc1)N(CCC(F)(F)F)C(=O)NC/C(N)=C1\CCNC\C1=N/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C24H25Cl2F3N6O2/c25-17-2-1-3-19(21(17)26)34-20-13-32-10-8-16(20)18(30)12-33-23(37)35(11-9-24(27,28)29)22(31)14-4-6-15(36)7-5-14/h1-7,31-32,36H,8-13,30H2,(H,33,37)/b18-16-,31-22+,34-20+ |
| InChIKey | CFGIIJAGJGQDMC-YOTJBWBWSA-N |
| XLogP | 4.97 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|