C28H30ClF3N4NaO4- — CID 178148570
sodium;1-chloro-2-methanidylbenzene;4-[2-[[(4-hydroxybenzenecarboximidoyl)-(3,3,3-trifluoropropyl)carbamoyl]amino]ethanimidoyl]-1-methylcyclohex-3-ene-1-carboxylic acid (PubChem CID 178148570) has the molecular formula C28H30ClF3N4NaO4- and a molecular weight of 602.01 g/mol. Its IUPAC name is sodium;1-chloro-2-methanidylbenzene;4-[2-[[(4-hydroxybenzenecarboximidoyl)-(3,3,3-trifluoropropyl)carbamoyl]amino]ethanimidoyl]-1-methylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | sodium;1-chloro-2-methanidylbenzene;4-[2-[[(4-hydroxybenzenecarboximidoyl)-(3,3,3-trifluoropropyl)carbamoyl]amino]ethanimidoyl]-1-methylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 178148570 |
| Molecular Formula | C28H30ClF3N4NaO4- |
| Molecular Weight | 602.01 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | sodium;1-chloro-2-methanidylbenzene;4-[2-[[(4-hydroxybenzenecarboximidoyl)-(3,3,3-trifluoropropyl)carbamoyl]amino]ethanimidoyl]-1-methylcyclohex-3-ene-1-carboxylic acid |
| SMILES | [CH2-]c1ccccc1Cl.[H]/N=C(\CNC(=O)N(CCC(F)(F)F)/C(=N/[H])c1ccc(O)cc1)C1=[C-]CC(C)(C(=O)O)CC1.[Na+] |
| InChI | InChI=1S/C21H24F3N4O4.C7H6Cl.Na/c1-20(18(30)31)8-6-13(7-9-20)16(25)12-27-19(32)28(11-10-21(22,23)24)17(26)14-2-4-15(29)5-3-14;1-6-4-2-3-5-7(6)8;/h2-5,25-26,29H,6,8-12H2,1H3,(H,27,32)(H,30,31);2-5H,1H2;/q2*-1;+1/b25-16+,26-17+;; |
| InChIKey | CFSUQEZLGZPHJY-ZMCCATLCSA-N |
| XLogP | 3.23 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.01 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|