C24H26ClF3N6O2 — CID 178148577
3-[(2Z)-2-amino-2-[3-(3-chlorophenyl)iminopiperidin-4-ylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea (PubChem CID 178148577) has the molecular formula C24H26ClF3N6O2 and a molecular weight of 522.96 g/mol. Its IUPAC name is 3-[(2Z)-2-amino-2-[3-(3-chlorophenyl)iminopiperidin-4-ylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea.
| Compound Name | 3-[(2Z)-2-amino-2-[3-(3-chlorophenyl)iminopiperidin-4-ylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 178148577 |
| Molecular Formula | C24H26ClF3N6O2 |
| Molecular Weight | 522.96 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 3-[(2Z)-2-amino-2-[3-(3-chlorophenyl)iminopiperidin-4-ylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
| SMILES | [H]/N=C(\c1ccc(O)cc1)N(CCC(F)(F)F)C(=O)NC/C(N)=C1\CCNC\C1=N/c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H26ClF3N6O2/c25-16-2-1-3-17(12-16)33-21-14-31-10-8-19(21)20(29)13-32-23(36)34(11-9-24(26,27)28)22(30)15-4-6-18(35)7-5-15/h1-7,12,30-31,35H,8-11,13-14,29H2,(H,32,36)/b20-19-,30-22+,33-21+ |
| InChIKey | KWZVBZBWXWOPRQ-BUKZQOHFSA-N |
| XLogP | 4.31 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.96 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|