C27H32F3N5O2 — CID 178148616
3-[(2Z)-2-amino-2-[4-methyl-2-(3-methylphenyl)iminocyclohexylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea (PubChem CID 178148616) has the molecular formula C27H32F3N5O2 and a molecular weight of 515.58 g/mol. Its IUPAC name is 3-[(2Z)-2-amino-2-[4-methyl-2-(3-methylphenyl)iminocyclohexylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea.
| Compound Name | 3-[(2Z)-2-amino-2-[4-methyl-2-(3-methylphenyl)iminocyclohexylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 178148616 |
| Molecular Formula | C27H32F3N5O2 |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | 3-[(2Z)-2-amino-2-[4-methyl-2-(3-methylphenyl)iminocyclohexylidene]ethyl]-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
| SMILES | [H]/N=C(\c1ccc(O)cc1)N(CCC(F)(F)F)C(=O)NC/C(N)=C1\CCC(C)C\C1=N/c1cccc(C)c1 |
| InChI | InChI=1S/C27H32F3N5O2/c1-17-4-3-5-20(14-17)34-24-15-18(2)6-11-22(24)23(31)16-33-26(37)35(13-12-27(28,29)30)25(32)19-7-9-21(36)10-8-19/h3-5,7-10,14,18,32,36H,6,11-13,15-16,31H2,1-2H3,(H,33,37)/b23-22-,32-25+,34-24+ |
| InChIKey | ZFFAAHRHDRXLSJ-QFOLFQCDSA-N |
| XLogP | 5.80 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|