C21H27N5O4 — CID 178148640
(2E,6Z)-5-[2-[[(4-hydroxybenzenecarboximidoyl)-(2-hydroxyethyl)carbamoyl]amino]ethanimidoyl]-2-methylocta-2,4,6-trienamide (PubChem CID 178148640) has the molecular formula C21H27N5O4 and a molecular weight of 413.48 g/mol. Its IUPAC name is (2E,6Z)-5-[2-[[(4-hydroxybenzenecarboximidoyl)-(2-hydroxyethyl)carbamoyl]amino]ethanimidoyl]-2-methylocta-2,4,6-trienamide.
| Compound Name | (2E,6Z)-5-[2-[[(4-hydroxybenzenecarboximidoyl)-(2-hydroxyethyl)carbamoyl]amino]ethanimidoyl]-2-methylocta-2,4,6-trienamide |
|---|---|
| PubChem CID | 178148640 |
| Molecular Formula | C21H27N5O4 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (2E,6Z)-5-[2-[[(4-hydroxybenzenecarboximidoyl)-(2-hydroxyethyl)carbamoyl]amino]ethanimidoyl]-2-methylocta-2,4,6-trienamide |
| SMILES | [H]/N=C(/CNC(=O)N(CCO)/C(=N/[H])c1ccc(O)cc1)C(=C/C=C(\C)C(N)=O)/C=C\C |
| InChI | InChI=1S/C21H27N5O4/c1-3-4-15(6-5-14(2)20(24)29)18(22)13-25-21(30)26(11-12-27)19(23)16-7-9-17(28)10-8-16/h3-10,22-23,27-28H,11-13H2,1-2H3,(H2,24,29)(H,25,30)/b4-3-,14-5+,15-6?,22-18-,23-19+ |
| InChIKey | RGKHMRYMMSQQNZ-KXNFQRRNSA-N |
| XLogP | 1.68 |
| TPSA | 163.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|