C10H20N2 — CID 178148756
ethane;1-(5-methyl-1,2,3,6-tetrahydropyridin-4-yl)ethanimine (PubChem CID 178148756) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is ethane;1-(5-methyl-1,2,3,6-tetrahydropyridin-4-yl)ethanimine.
| Compound Name | ethane;1-(5-methyl-1,2,3,6-tetrahydropyridin-4-yl)ethanimine |
|---|---|
| PubChem CID | 178148756 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | ethane;1-(5-methyl-1,2,3,6-tetrahydropyridin-4-yl)ethanimine |
| SMILES | CC.[H]/N=C(\C)C1=C(C)CNCC1 |
| InChI | InChI=1S/C8H14N2.C2H6/c1-6-5-10-4-3-8(6)7(2)9;1-2/h9-10H,3-5H2,1-2H3;1-2H3/b9-7+; |
| InChIKey | HTJXFXDVILRVSG-BXTVWIJMSA-N |
| XLogP | 2.36 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|