C29H29ClF3N5O4 — CID 178148859
1-[(2-chlorophenyl)methyl]-3-[[[(4-hydroxybenzenecarboximidoyl)-(3,3,3-trifluoropropyl)carbamoyl]amino]methyl]indazole-6-carboxylic acid;ethane (PubChem CID 178148859) has the molecular formula C29H29ClF3N5O4 and a molecular weight of 604.03 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-[[[(4-hydroxybenzenecarboximidoyl)-(3,3,3-trifluoropropyl)carbamoyl]amino]methyl]indazole-6-carboxylic acid;ethane.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-[[[(4-hydroxybenzenecarboximidoyl)-(3,3,3-trifluoropropyl)carbamoyl]amino]methyl]indazole-6-carboxylic acid;ethane |
|---|---|
| PubChem CID | 178148859 |
| Molecular Formula | C29H29ClF3N5O4 |
| Molecular Weight | 604.03 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-[[[(4-hydroxybenzenecarboximidoyl)-(3,3,3-trifluoropropyl)carbamoyl]amino]methyl]indazole-6-carboxylic acid;ethane |
| SMILES | CC.[H]/N=C(\c1ccc(O)cc1)N(CCC(F)(F)F)C(=O)NCc1nn(Cc2ccccc2Cl)c2cc(C(=O)O)ccc12 |
| InChI | InChI=1S/C27H23ClF3N5O4.C2H6/c28-21-4-2-1-3-18(21)15-36-23-13-17(25(38)39)7-10-20(23)22(34-36)14-33-26(40)35(12-11-27(29,30)31)24(32)16-5-8-19(37)9-6-16;1-2/h1-10,13,32,37H,11-12,14-15H2,(H,33,40)(H,38,39);1-2H3/b32-24+; |
| InChIKey | OHFZAEYCQXVCQL-TWJGMXQDSA-N |
| XLogP | 6.66 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.03 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|