C22H31F3N4O2 — CID 178148886
3-(3-butyl-2-iminohept-3-enyl)-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea (PubChem CID 178148886) has the molecular formula C22H31F3N4O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 3-(3-butyl-2-iminohept-3-enyl)-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea.
| Compound Name | 3-(3-butyl-2-iminohept-3-enyl)-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 178148886 |
| Molecular Formula | C22H31F3N4O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 3-(3-butyl-2-iminohept-3-enyl)-1-(4-hydroxybenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea |
| SMILES | [H]/N=C(/CNC(=O)N(CCC(F)(F)F)/C(=N/[H])c1ccc(O)cc1)C(=CCCC)CCCC |
| InChI | InChI=1S/C22H31F3N4O2/c1-3-5-7-16(8-6-4-2)19(26)15-28-21(31)29(14-13-22(23,24)25)20(27)17-9-11-18(30)12-10-17/h7,9-12,26-27,30H,3-6,8,13-15H2,1-2H3,(H,28,31)/b16-7?,26-19-,27-20+ |
| InChIKey | ISFSUIBWMGWIPT-PYWDOBQTSA-N |
| XLogP | 5.62 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|