C37H48ClF3N6O — CID 178149008
3-[[6-(1-aminoethenyl)-1-[(2-chlorophenyl)methyl]indazol-3-yl]methyl]-1-(4-butan-2-ylbenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea;ethane;propane (PubChem CID 178149008) has the molecular formula C37H48ClF3N6O and a molecular weight of 685.28 g/mol. Its IUPAC name is 3-[[6-(1-aminoethenyl)-1-[(2-chlorophenyl)methyl]indazol-3-yl]methyl]-1-(4-butan-2-ylbenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea;ethane;propane.
| Compound Name | 3-[[6-(1-aminoethenyl)-1-[(2-chlorophenyl)methyl]indazol-3-yl]methyl]-1-(4-butan-2-ylbenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea;ethane;propane |
|---|---|
| PubChem CID | 178149008 |
| Molecular Formula | C37H48ClF3N6O |
| Molecular Weight | 685.28 g/mol |
| Exact Mass | 684.35 |
| IUPAC Name | 3-[[6-(1-aminoethenyl)-1-[(2-chlorophenyl)methyl]indazol-3-yl]methyl]-1-(4-butan-2-ylbenzenecarboximidoyl)-1-(3,3,3-trifluoropropyl)urea;ethane;propane |
| SMILES | CC.CCC.[H]/N=C(\c1ccc(C(C)CC)cc1)N(CCC(F)(F)F)C(=O)NCc1nn(Cc2ccccc2Cl)c2cc(C(=C)N)ccc12 |
| InChI | InChI=1S/C32H34ClF3N6O.C3H8.C2H6/c1-4-20(2)22-9-11-23(12-10-22)30(38)41(16-15-32(34,35)36)31(43)39-18-28-26-14-13-24(21(3)37)17-29(26)42(40-28)19-25-7-5-6-8-27(25)33;1-3-2;1-2/h5-14,17,20,38H,3-4,15-16,18-19,37H2,1-2H3,(H,39,43);3H2,1-2H3;1-2H3/b38-30+;; |
| InChIKey | YOYVRKUUYVLCHU-YZKRWZFNSA-N |
| XLogP | 10.11 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.28 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|