About ethane;2-ethenylimino-N,3-dimethylbut-3-enamide
ethane;2-ethenylimino-N,3-dimethylbut-3-enamide (PubChem CID 178149715) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is ethane;2-ethenylimino-N,3-dimethylbut-3-enamide.
Molecular Properties
| Compound Name | ethane;2-ethenylimino-N,3-dimethylbut-3-enamide |
| PubChem CID | 178149715 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | ethane;2-ethenylimino-N,3-dimethylbut-3-enamide |
| SMILES | C=C/N=C(\C(=C)C)C(=O)NC.CC.CC |
| InChI | InChI=1S/C8H12N2O.2C2H6/c1-5-10-7(6(2)3)8(11)9-4;2*1-2/h5H,1-2H2,3-4H3,(H,9,11);2*1-2H3/b10-7+;; |
| InChIKey | GLONCZXEFGPCHG-WRQJSNHTSA-N |
| XLogP | 2.95 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-ethenylimino-N,3-dimethylbut-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethenylimino-N,3-dimethylbut-3-enamide?
The IUPAC name of ethane;2-ethenylimino-N,3-dimethylbut-3-enamide (CID 178149715) is ethane;2-ethenylimino-N,3-dimethylbut-3-enamide.
What is the SMILES notation for ethane;2-ethenylimino-N,3-dimethylbut-3-enamide?
The canonical SMILES for ethane;2-ethenylimino-N,3-dimethylbut-3-enamide is C=C/N=C(\C(=C)C)C(=O)NC.CC.CC.
What is the InChIKey of ethane;2-ethenylimino-N,3-dimethylbut-3-enamide?
The InChIKey is GLONCZXEFGPCHG-WRQJSNHTSA-N. The full InChI is InChI=1S/C8H12N2O.2C2H6/c1-5-10-7(6(2)3)8(11)9-4;2*1-2/h5H,1-2H2,3-4H3,(H,9,11);2*1-2H3/b10-7+;;.
What are the key properties of ethane;2-ethenylimino-N,3-dimethylbut-3-enamide?
ethane;2-ethenylimino-N,3-dimethylbut-3-enamide has a molecular weight of 212.34 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethenylimino-N,3-dimethylbut-3-enamide is sourced from PubChem (CID 178149715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).