C21H31FN2O2 — CID 178150135
1-[(2R)-2-tert-butyl-4-[(2R)-2-(3-fluoro-4-methylphenyl)-2-methoxyethyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 178150135) has the molecular formula C21H31FN2O2 and a molecular weight of 362.49 g/mol. Its IUPAC name is 1-[(2R)-2-tert-butyl-4-[(2R)-2-(3-fluoro-4-methylphenyl)-2-methoxyethyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R)-2-tert-butyl-4-[(2R)-2-(3-fluoro-4-methylphenyl)-2-methoxyethyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 178150135 |
| Molecular Formula | C21H31FN2O2 |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 1-[(2R)-2-tert-butyl-4-[(2R)-2-(3-fluoro-4-methylphenyl)-2-methoxyethyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C[C@H](OC)c2ccc(C)c(F)c2)C[C@H]1C(C)(C)C |
| InChI | InChI=1S/C21H31FN2O2/c1-7-20(25)24-11-10-23(14-19(24)21(3,4)5)13-18(26-6)16-9-8-15(2)17(22)12-16/h7-9,12,18-19H,1,10-11,13-14H2,2-6H3/t18-,19-/m0/s1 |
| InChIKey | AYTIWHZCZHPWKW-OALUTQOASA-N |
| XLogP | 3.57 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|